C26H26ClN3O6 — CID 126168529
propan-2-yl 3-[5-[(Z)-[[(2S)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126168529) has the molecular formula C26H26ClN3O6 and a molecular weight of 511.96 g/mol. Its IUPAC name is propan-2-yl 3-[5-[(Z)-[[(2S)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | propan-2-yl 3-[5-[(Z)-[[(2S)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126168529 |
| Molecular Formula | C26H26ClN3O6 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | propan-2-yl 3-[5-[(Z)-[[(2S)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(-c2ccc(/C=N\NC(=O)[C@H](C)NC(=O)COc3ccccc3Cl)o2)c1 |
| InChI | InChI=1S/C26H26ClN3O6/c1-16(2)35-26(33)19-8-6-7-18(13-19)22-12-11-20(36-22)14-28-30-25(32)17(3)29-24(31)15-34-23-10-5-4-9-21(23)27/h4-14,16-17H,15H2,1-3H3,(H,29,31)(H,30,32)/b28-14-/t17-/m0/s1 |
| InChIKey | YXRVTEMZOLZEIF-QWKVUHSCSA-N |
| XLogP | 4.20 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|