C23H22N2O4 — CID 126181380
propan-2-yl 3-[5-[(Z)-[(4-methylbenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126181380) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is propan-2-yl 3-[5-[(Z)-[(4-methylbenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | propan-2-yl 3-[5-[(Z)-[(4-methylbenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126181380 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | propan-2-yl 3-[5-[(Z)-[(4-methylbenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | Cc1ccc(C(=O)N/N=C\c2ccc(-c3cccc(C(=O)OC(C)C)c3)o2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-15(2)28-23(27)19-6-4-5-18(13-19)21-12-11-20(29-21)14-24-25-22(26)17-9-7-16(3)8-10-17/h4-15H,1-3H3,(H,25,26)/b24-14- |
| InChIKey | PVVWEEFRQRVOKP-OYKKKHCWSA-N |
| XLogP | 4.58 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|