C28H22N4O6 — CID 27059659
N-[(E)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]oxamide (PubChem CID 27059659) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is N-[(E)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]oxamide.
| Compound Name | N-[(E)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 27059659 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | N-[(E)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(3-acetylphenyl)furan-2-yl]methylideneamino]oxamide |
| SMILES | CC(=O)c1cccc(-c2ccc(/C=N\NC(=O)C(=O)N/N=C/c3ccc(-c4cccc(C(C)=O)c4)o3)o2)c1 |
| InChI | InChI=1S/C28H22N4O6/c1-17(33)19-5-3-7-21(13-19)25-11-9-23(37-25)15-29-31-27(35)28(36)32-30-16-24-10-12-26(38-24)22-8-4-6-20(14-22)18(2)34/h3-16H,1-2H3,(H,31,35)(H,32,36)/b29-15-,30-16+ |
| InChIKey | AFPFPDRIMJJNCH-CBTGBURPSA-N |
| XLogP | 4.21 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|