C23H25ClN4O3 — CID 126163801
(2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]propanamide (PubChem CID 126163801) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is (2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 126163801 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]propanamide |
| SMILES | CC(C)n1cc(/C=N\NC(=O)[C@@H](C)NC(=O)COc2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C23H25ClN4O3/c1-15(2)28-13-17(18-8-4-6-10-20(18)28)12-25-27-23(30)16(3)26-22(29)14-31-21-11-7-5-9-19(21)24/h4-13,15-16H,14H2,1-3H3,(H,26,29)(H,27,30)/b25-12-/t16-/m1/s1 |
| InChIKey | VYZZXVLQIQMDNX-YQWDGLBASA-N |
| XLogP | 3.91 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|