C29H36N4O3 — CID 126181006
(2R)-3-methyl-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide (PubChem CID 126181006) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is (2R)-3-methyl-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide.
| Compound Name | (2R)-3-methyl-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 126181006 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (2R)-3-methyl-N-[(Z)-(1-propan-2-ylindol-3-yl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide |
| SMILES | CC(C)[C@@H](NC(=O)COc1ccc2c(c1)CCCC2)C(=O)N/N=C\c1cn(C(C)C)c2ccccc12 |
| InChI | InChI=1S/C29H36N4O3/c1-19(2)28(31-27(34)18-36-24-14-13-21-9-5-6-10-22(21)15-24)29(35)32-30-16-23-17-33(20(3)4)26-12-8-7-11-25(23)26/h7-8,11-17,19-20,28H,5-6,9-10,18H2,1-4H3,(H,31,34)(H,32,35)/b30-16-/t28-/m1/s1 |
| InChIKey | OILPBNJWIBDTFS-MVQLQSSVSA-N |
| XLogP | 4.77 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|