C29H32N4O6 — CID 126157070
(2R)-3-methyl-N-[(Z)-[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide (PubChem CID 126157070) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is (2R)-3-methyl-N-[(Z)-[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide.
| Compound Name | (2R)-3-methyl-N-[(Z)-[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 126157070 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (2R)-3-methyl-N-[(Z)-[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]butanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1ccc(/C=N\NC(=O)[C@H](NC(=O)COc2ccc3c(c2)CCCC3)C(C)C)o1 |
| InChI | InChI=1S/C29H32N4O6/c1-18(2)28(31-27(34)17-38-23-10-8-20-6-4-5-7-21(20)15-23)29(35)32-30-16-24-11-13-26(39-24)25-12-9-22(33(36)37)14-19(25)3/h8-16,18,28H,4-7,17H2,1-3H3,(H,31,34)(H,32,35)/b30-16-/t28-/m1/s1 |
| InChIKey | DSEGIPLTGXPKKB-MVQLQSSVSA-N |
| XLogP | 4.71 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|