C25H24N4O7 — CID 6871847
N-[(2R)-3-methyl-1-[(2E)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 6871847) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is N-[(2R)-3-methyl-1-[(2E)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2R)-3-methyl-1-[(2E)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6871847 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[(2R)-3-methyl-1-[(2E)-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=N/NC(=O)[C@H](NC(=O)c2ccc3c(c2)OCO3)C(C)C)o1 |
| InChI | InChI=1S/C25H24N4O7/c1-14(2)23(27-24(30)16-5-8-21-22(10-16)35-13-34-21)25(31)28-26-12-18-7-9-20(36-18)19-11-17(29(32)33)6-4-15(19)3/h4-12,14,23H,13H2,1-3H3,(H,27,30)(H,28,31)/b26-12+/t23-/m1/s1 |
| InChIKey | GFMOOXKWORKVPD-JXHYGPBUSA-N |
| XLogP | 3.80 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|