C24H23FN4O5 — CID 126172434
2-fluoro-N-[(2R)-3-methyl-1-[(2Z)-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 126172434) has the molecular formula C24H23FN4O5 and a molecular weight of 466.47 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-3-methyl-1-[(2Z)-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[(2R)-3-methyl-1-[(2Z)-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 126172434 |
| Molecular Formula | C24H23FN4O5 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-fluoro-N-[(2R)-3-methyl-1-[(2Z)-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1ccc(/C=N\NC(=O)[C@H](NC(=O)c2ccccc2F)C(C)C)o1 |
| InChI | InChI=1S/C24H23FN4O5/c1-14(2)22(27-23(30)19-6-4-5-7-20(19)25)24(31)28-26-13-17-9-11-21(34-17)18-10-8-16(29(32)33)12-15(18)3/h4-14,22H,1-3H3,(H,27,30)(H,28,31)/b26-13-/t22-/m1/s1 |
| InChIKey | CUXKBHKDDJGZIE-YICJJFKUSA-N |
| XLogP | 4.21 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|