C23H20ClN3O6 — CID 126170071
2-[5-[(Z)-[[(2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126170071) has the molecular formula C23H20ClN3O6 and a molecular weight of 469.88 g/mol. Its IUPAC name is 2-[5-[(Z)-[[(2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(Z)-[[(2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126170071 |
| Molecular Formula | C23H20ClN3O6 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-[5-[(Z)-[[(2R)-2-[[2-(2-chlorophenoxy)acetyl]amino]propanoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | C[C@@H](NC(=O)COc1ccccc1Cl)C(=O)N/N=C\c1ccc(-c2ccccc2C(=O)O)o1 |
| InChI | InChI=1S/C23H20ClN3O6/c1-14(26-21(28)13-32-20-9-5-4-8-18(20)24)22(29)27-25-12-15-10-11-19(33-15)16-6-2-3-7-17(16)23(30)31/h2-12,14H,13H2,1H3,(H,26,28)(H,27,29)(H,30,31)/b25-12-/t14-/m1/s1 |
| InChIKey | XVVTYTILRHCUDS-QTYGBZKPSA-N |
| XLogP | 3.33 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|