C26H25Cl4N3O4 — CID 126020090
(2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide (PubChem CID 126020090) has the molecular formula C26H25Cl4N3O4 and a molecular weight of 585.32 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide.
| Compound Name | (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126020090 |
| Molecular Formula | C26H25Cl4N3O4 |
| Molecular Weight | 585.32 g/mol |
| Exact Mass | 583.06 |
| IUPAC Name | (2R)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl)C(=O)N/N=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C26H25Cl4N3O4/c1-14(2)11-21(32-25(34)15(3)36-23-9-7-16(27)12-20(23)29)26(35)33-31-13-17-8-10-22(37-17)18-5-4-6-19(28)24(18)30/h4-10,12-15,21H,11H2,1-3H3,(H,32,34)(H,33,35)/b31-13-/t15-,21-/m1/s1 |
| InChIKey | KOGQEZPBILHPOG-LCLRSTJXSA-N |
| XLogP | 7.01 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.32 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|