C27H26ClN3O — CID 133144118
N-[(E)-[1-[(3-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133144118) has the molecular formula C27H26ClN3O and a molecular weight of 443.98 g/mol. Its IUPAC name is N-[(E)-[1-[(3-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-[1-[(3-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133144118 |
| Molecular Formula | C27H26ClN3O |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[(E)-[1-[(3-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2c(C)n(Cc3cccc(Cl)c3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C27H26ClN3O/c1-18-11-12-22(19(2)13-18)15-27(32)30-29-16-25-20(3)31(26-10-5-4-9-24(25)26)17-21-7-6-8-23(28)14-21/h4-14,16H,15,17H2,1-3H3,(H,30,32)/b29-16+ |
| InChIKey | IZSYVYPVKOGOTR-MUFRIFMGSA-N |
| XLogP | 5.96 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|