C26H23Cl2N3O2 — CID 4033495
N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide (PubChem CID 4033495) has the molecular formula C26H23Cl2N3O2 and a molecular weight of 480.40 g/mol. Its IUPAC name is N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4033495 |
| Molecular Formula | C26H23Cl2N3O2 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-[[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NN=Cc2c(C)n(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O2/c1-17-22(15-29-30-26(32)14-18-7-10-20(33-2)11-8-18)21-5-3-4-6-25(21)31(17)16-19-9-12-23(27)24(28)13-19/h3-13,15H,14,16H2,1-2H3,(H,30,32) |
| InChIKey | ASNZIYRUKJLFLH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|