C19H18ClN3O — CID 5425745
2-(4-chlorophenyl)-N-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]acetamide (PubChem CID 5425745) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5425745 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]acetamide |
| SMILES | Cc1c(/C=N\NC(=O)Cc2ccc(Cl)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C19H18ClN3O/c1-13-17(16-5-3-4-6-18(16)23(13)2)12-21-22-19(24)11-14-7-9-15(20)10-8-14/h3-10,12H,11H2,1-2H3,(H,22,24)/b21-12- |
| InChIKey | GCJXDEJSPDNILN-MTJSOVHGSA-N |
| XLogP | 3.83 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|