C21H22BrN3O2 — CID 1216078
2-(4-bromo-2,6-dimethylphenoxy)-N-[(1,2-dimethylindol-3-yl)methylideneamino]acetamide (PubChem CID 1216078) has the molecular formula C21H22BrN3O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylphenoxy)-N-[(1,2-dimethylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2,6-dimethylphenoxy)-N-[(1,2-dimethylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1216078 |
| Molecular Formula | C21H22BrN3O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylphenoxy)-N-[(1,2-dimethylindol-3-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(Br)cc(C)c1OCC(=O)NN=Cc1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C21H22BrN3O2/c1-13-9-16(22)10-14(2)21(13)27-12-20(26)24-23-11-18-15(3)25(4)19-8-6-5-7-17(18)19/h5-11H,12H2,1-4H3,(H,24,26) |
| InChIKey | GXGJEWQZCQXHRG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|