C23H25N3O4 — CID 172924330
4-(3,4-dimethoxyphenyl)-N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-4-oxobutanamide (PubChem CID 172924330) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-4-oxobutanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-4-oxobutanamide |
|---|---|
| PubChem CID | 172924330 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)N/N=C/c2c(C)n(C)c3ccccc23)cc1OC |
| InChI | InChI=1S/C23H25N3O4/c1-15-18(17-7-5-6-8-19(17)26(15)2)14-24-25-23(28)12-10-20(27)16-9-11-21(29-3)22(13-16)30-4/h5-9,11,13-14H,10,12H2,1-4H3,(H,25,28)/b24-14+ |
| InChIKey | XGVSBGLGKRDKNN-ZVHZXABRSA-N |
| XLogP | 3.62 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|