C33H25ClN4O — CID 126044502
N-[(E)-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126044502) has the molecular formula C33H25ClN4O and a molecular weight of 529.04 g/mol. Its IUPAC name is N-[(E)-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126044502 |
| Molecular Formula | C33H25ClN4O |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | N-[(E)-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1c(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c2ccccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H25ClN4O/c1-22-29(27-12-6-8-14-32(27)38(22)21-23-15-17-25(34)18-16-23)20-35-37-33(39)28-19-31(24-9-3-2-4-10-24)36-30-13-7-5-11-26(28)30/h2-20H,21H2,1H3,(H,37,39)/b35-20+ |
| InChIKey | DMAHYSKIUGCRSZ-JEPNHJGPSA-N |
| XLogP | 7.63 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|