C30H24N4O — CID 126043423
N-[(E)-(2,5-dimethyl-1-prop-2-ynylindol-3-yl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126043423) has the molecular formula C30H24N4O and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethyl-1-prop-2-ynylindol-3-yl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-(2,5-dimethyl-1-prop-2-ynylindol-3-yl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126043423 |
| Molecular Formula | C30H24N4O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[(E)-(2,5-dimethyl-1-prop-2-ynylindol-3-yl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | C#CCn1c(C)c(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c2cc(C)ccc21 |
| InChI | InChI=1S/C30H24N4O/c1-4-16-34-21(3)26(24-17-20(2)14-15-29(24)34)19-31-33-30(35)25-18-28(22-10-6-5-7-11-22)32-27-13-9-8-12-23(25)27/h1,5-15,17-19H,16H2,2-3H3,(H,33,35)/b31-19+ |
| InChIKey | WVXLUZLJNKLRBD-ZCTHSVRISA-N |
| XLogP | 5.87 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|