C29H25FN4O — CID 126394581
N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide (PubChem CID 126394581) has the molecular formula C29H25FN4O and a molecular weight of 464.54 g/mol. Its IUPAC name is N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide.
| Compound Name | N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide |
|---|---|
| PubChem CID | 126394581 |
| Molecular Formula | C29H25FN4O |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[(Z)-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-2-(naphthalen-1-ylamino)acetamide |
| SMILES | Cc1c(/C=N\NC(=O)CNc2cccc3ccccc23)c2ccccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H25FN4O/c1-20-26(25-10-4-5-12-28(25)34(20)19-21-13-15-23(30)16-14-21)17-32-33-29(35)18-31-27-11-6-8-22-7-2-3-9-24(22)27/h2-17,31H,18-19H2,1H3,(H,33,35)/b32-17- |
| InChIKey | BQZNBLIRLJCXLB-KYHGBAKBSA-N |
| XLogP | 5.85 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|