C19H17Cl2N3O — CID 126375327
2,4-dichloro-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide (PubChem CID 126375327) has the molecular formula C19H17Cl2N3O and a molecular weight of 374.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126375327 |
| Molecular Formula | C19H17Cl2N3O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]benzamide |
| SMILES | CCn1c(C)c(/C=N\NC(=O)c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C19H17Cl2N3O/c1-3-24-12(2)16(14-6-4-5-7-18(14)24)11-22-23-19(25)15-9-8-13(20)10-17(15)21/h4-11H,3H2,1-2H3,(H,23,25)/b22-11- |
| InChIKey | CHSPPFQJTHQENB-JJFYIABZSA-N |
| XLogP | 5.04 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|