C18H16N4O2 — CID 3879829
N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]benzamide (PubChem CID 3879829) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]benzamide.
| Compound Name | N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3879829 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]benzamide |
| SMILES | NC(=O)Cn1cc(C=NNC(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H16N4O2/c19-17(23)12-22-11-14(15-8-4-5-9-16(15)22)10-20-21-18(24)13-6-2-1-3-7-13/h1-11H,12H2,(H2,19,23)(H,21,24) |
| InChIKey | WDLNNBXQLNCBMA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|