C25H20FN5O3 — CID 3251121
N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide (PubChem CID 3251121) has the molecular formula C25H20FN5O3 and a molecular weight of 457.47 g/mol. Its IUPAC name is N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide.
| Compound Name | N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 3251121 |
| Molecular Formula | C25H20FN5O3 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-[(2-fluorobenzoyl)amino]benzamide |
| SMILES | NC(=O)Cn1cc(C=NNC(=O)c2ccccc2NC(=O)c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C25H20FN5O3/c26-20-10-4-1-8-18(20)24(33)29-21-11-5-2-9-19(21)25(34)30-28-13-16-14-31(15-23(27)32)22-12-6-3-7-17(16)22/h1-14H,15H2,(H2,27,32)(H,29,33)(H,30,34) |
| InChIKey | WTZBUCIEAXRUTO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|