C17H16N4O3 — CID 6372429
N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-methylfuran-3-carboxamide (PubChem CID 6372429) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 6372429 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(Z)-[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N/N=C\c1cn(CC(N)=O)c2ccccc12 |
| InChI | InChI=1S/C17H16N4O3/c1-11-13(6-7-24-11)17(23)20-19-8-12-9-21(10-16(18)22)15-5-3-2-4-14(12)15/h2-9H,10H2,1H3,(H2,18,22)(H,20,23)/b19-8- |
| InChIKey | PKJGPJCJEMMPOF-UWVJOHFNSA-N |
| XLogP | 1.79 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|