C20H16N4O3 — CID 3919047
N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 3919047) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3919047 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[[1-(2-amino-2-oxoethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)Cn1cc(C=NNC(=O)c2cc3ccccc3o2)c2ccccc21 |
| InChI | InChI=1S/C20H16N4O3/c21-19(25)12-24-11-14(15-6-2-3-7-16(15)24)10-22-23-20(26)18-9-13-5-1-4-8-17(13)27-18/h1-11H,12H2,(H2,21,25)(H,23,26) |
| InChIKey | PMTVALFOWHYDRW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|