C29H19BrIN3O2 — CID 126022240
5-bromo-7-iodo-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126022240) has the molecular formula C29H19BrIN3O2 and a molecular weight of 648.30 g/mol. Its IUPAC name is 5-bromo-7-iodo-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-7-iodo-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126022240 |
| Molecular Formula | C29H19BrIN3O2 |
| Molecular Weight | 648.30 g/mol |
| Exact Mass | 646.97 |
| IUPAC Name | 5-bromo-7-iodo-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cn(Cc2cccc3ccccc23)c2ccccc12)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C29H19BrIN3O2/c30-22-12-20-13-27(36-28(20)25(31)14-22)29(35)33-32-15-21-17-34(26-11-4-3-10-24(21)26)16-19-8-5-7-18-6-1-2-9-23(18)19/h1-15,17H,16H2,(H,33,35)/b32-15- |
| InChIKey | OYZOVPNPDNPMLZ-CNCDYAKUSA-N |
| XLogP | 7.72 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.30 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|