C30H25N3O3 — CID 126367952
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide (PubChem CID 126367952) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126367952 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)N/N=C\c1cn(Cc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C30H25N3O3/c34-30(17-21-12-13-28-29(16-21)36-15-14-35-28)32-31-18-24-20-33(27-11-4-3-10-26(24)27)19-23-8-5-7-22-6-1-2-9-25(22)23/h1-13,16,18,20H,14-15,17,19H2,(H,32,34)/b31-18- |
| InChIKey | KYGKXKNHUGSYLC-MNBJERMJSA-N |
| XLogP | 5.31 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|