C27H22N4O3 — CID 126365283
N-[(Z)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 126365283) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[(Z)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | N-[(Z)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 126365283 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(Z)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | N#Cc1ccccc1Cn1cc(/C=N\NC(=O)Cc2ccc3c(c2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C27H22N4O3/c28-15-20-5-1-2-6-21(20)17-31-18-22(23-7-3-4-8-24(23)31)16-29-30-27(32)14-19-9-10-25-26(13-19)34-12-11-33-25/h1-10,13,16,18H,11-12,14,17H2,(H,30,32)/b29-16- |
| InChIKey | DLNZKDSKFXKQGK-MWLSYYOVSA-N |
| XLogP | 4.03 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|