C19H16N4O — CID 9058755
N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]benzamide (PubChem CID 9058755) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]benzamide.
| Compound Name | N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9058755 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]benzamide |
| SMILES | N#CCCn1cc(/C=N\NC(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H16N4O/c20-11-6-12-23-14-16(17-9-4-5-10-18(17)23)13-21-22-19(24)15-7-2-1-3-8-15/h1-5,7-10,13-14H,6,12H2,(H,22,24)/b21-13- |
| InChIKey | FKDDRDSAYULQJO-BKUYFWCQSA-N |
| XLogP | 3.32 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|