C20H17N7O — CID 8976104
2-(benzotriazol-1-yl)-N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]acetamide (PubChem CID 8976104) has the molecular formula C20H17N7O and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 8976104 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[(Z)-[1-(2-cyanoethyl)indol-3-yl]methylideneamino]acetamide |
| SMILES | N#CCCn1cc(/C=N\NC(=O)Cn2nnc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C20H17N7O/c21-10-5-11-26-13-15(16-6-1-3-8-18(16)26)12-22-24-20(28)14-27-19-9-4-2-7-17(19)23-25-27/h1-4,6-9,12-13H,5,11,14H2,(H,24,28)/b22-12- |
| InChIKey | MKYJFGJPLXLSIS-UUYOSTAYSA-N |
| XLogP | 2.45 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|