C15H10N4 — CID 30234194
2-[[1-(2-cyanoethyl)indol-3-yl]methylidene]propanedinitrile (PubChem CID 30234194) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-[[1-(2-cyanoethyl)indol-3-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[1-(2-cyanoethyl)indol-3-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 30234194 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[[1-(2-cyanoethyl)indol-3-yl]methylidene]propanedinitrile |
| SMILES | N#CCCn1cc(C=C(C#N)C#N)c2ccccc21 |
| InChI | InChI=1S/C15H10N4/c16-6-3-7-19-11-13(8-12(9-17)10-18)14-4-1-2-5-15(14)19/h1-2,4-5,8,11H,3,7H2 |
| InChIKey | XPAZGMGBQVQQCN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|