C19H15N5 — CID 9023975
3-[3-[(Z)-benzimidazol-1-yliminomethyl]indol-1-yl]propanenitrile (PubChem CID 9023975) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-[3-[(Z)-benzimidazol-1-yliminomethyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(Z)-benzimidazol-1-yliminomethyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 9023975 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-[3-[(Z)-benzimidazol-1-yliminomethyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(/C=N\n2cnc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C19H15N5/c20-10-5-11-23-13-15(16-6-1-3-8-18(16)23)12-22-24-14-21-17-7-2-4-9-19(17)24/h1-4,6-9,12-14H,5,11H2/b22-12- |
| InChIKey | JNIUAAWKOBZQFU-UUYOSTAYSA-N |
| XLogP | 3.79 |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|