C27H19N5O3 — CID 3927697
3-[3-[2-[3-(3-nitrophenyl)-4-oxoquinazolin-2-yl]ethenyl]indol-1-yl]propanenitrile (PubChem CID 3927697) has the molecular formula C27H19N5O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[3-[2-[3-(3-nitrophenyl)-4-oxoquinazolin-2-yl]ethenyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-[3-(3-nitrophenyl)-4-oxoquinazolin-2-yl]ethenyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 3927697 |
| Molecular Formula | C27H19N5O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3-[3-[2-[3-(3-nitrophenyl)-4-oxoquinazolin-2-yl]ethenyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C=Cc2nc3ccccc3c(=O)n2-c2cccc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C27H19N5O3/c28-15-6-16-30-18-19(22-9-2-4-12-25(22)30)13-14-26-29-24-11-3-1-10-23(24)27(33)31(26)20-7-5-8-21(17-20)32(34)35/h1-5,7-14,17-18H,6,16H2 |
| InChIKey | ASQQQWHNEXRFBT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|