C22H15N3O5 — CID 3628212
2-[2-(3,4-dihydroxyphenyl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one (PubChem CID 3628212) has the molecular formula C22H15N3O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxyphenyl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one.
| Compound Name | 2-[2-(3,4-dihydroxyphenyl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3628212 |
| Molecular Formula | C22H15N3O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C=Cc2ccc(O)c(O)c2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15N3O5/c26-19-11-5-14(13-20(19)27)6-12-21-23-18-4-2-1-3-17(18)22(28)24(21)15-7-9-16(10-8-15)25(29)30/h1-13,26-27H |
| InChIKey | UZXASLBIBKIDPW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|