C23H18N2O3 — CID 135549536
2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 135549536) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 135549536 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(/C=C/c2ccc(O)c(O)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H18N2O3/c1-15-6-2-5-9-19(15)25-22(13-11-16-10-12-20(26)21(27)14-16)24-18-8-4-3-7-17(18)23(25)28/h2-14,26-27H,1H3/b13-11+ |
| InChIKey | MMTLSQITBROQJZ-ACCUITESSA-N |
| XLogP | 4.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|