C24H21N3O3 — CID 137092663
2-[2-(2-ethoxy-3-hydroxy-4-pyridinyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 137092663) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[2-(2-ethoxy-3-hydroxy-4-pyridinyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(2-ethoxy-3-hydroxy-4-pyridinyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 137092663 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[2-(2-ethoxy-3-hydroxy-4-pyridinyl)ethenyl]-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | CCOc1nccc(C=Cc2nc3ccccc3c(=O)n2-c2ccccc2C)c1O |
| InChI | InChI=1S/C24H21N3O3/c1-3-30-23-22(28)17(14-15-25-23)12-13-21-26-19-10-6-5-9-18(19)24(29)27(21)20-11-7-4-8-16(20)2/h4-15,28H,3H2,1-2H3 |
| InChIKey | OVYUHIZXYWISOP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |