C25H23N5O — CID 16575266
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 16575266) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16575266 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)/C=C/c1cn(CCC#N)c2ccccc12 |
| InChI | InChI=1S/C25H23N5O/c1-18-25(19(2)30(28-18)21-9-4-3-5-10-21)27-24(31)14-13-20-17-29(16-8-15-26)23-12-7-6-11-22(20)23/h3-7,9-14,17H,8,16H2,1-2H3,(H,27,31)/b14-13+ |
| InChIKey | UWHWVLQVOQGKIB-BUHFOSPRSA-N |
| XLogP | 5.01 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|