C22H28N4O2 — CID 51146645
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-2-morpholin-4-ylpropyl)prop-2-enamide (PubChem CID 51146645) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-2-morpholin-4-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-2-morpholin-4-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 51146645 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-2-morpholin-4-ylpropyl)prop-2-enamide |
| SMILES | CC(C)(CNC(=O)/C=C/c1cn(CCC#N)c2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C22H28N4O2/c1-22(2,26-12-14-28-15-13-26)17-24-21(27)9-8-18-16-25(11-5-10-23)20-7-4-3-6-19(18)20/h3-4,6-9,16H,5,11-15,17H2,1-2H3,(H,24,27)/b9-8+ |
| InChIKey | YURCFXDEYLPHGL-CMDGGOBGSA-N |
| XLogP | 2.80 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|