C23H24N4O3S — CID 41267097
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]prop-2-enamide (PubChem CID 41267097) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 41267097 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]prop-2-enamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CNC(=O)/C=C/c1cn(CCC#N)c2ccccc12 |
| InChI | InChI=1S/C23H24N4O3S/c1-26(2)31(29,30)22-11-6-3-8-18(22)16-25-23(28)13-12-19-17-27(15-7-14-24)21-10-5-4-9-20(19)21/h3-6,8-13,17H,7,15-16H2,1-2H3,(H,25,28)/b13-12+ |
| InChIKey | JWYPLCFMWOZZJX-OUKQBFOZSA-N |
| XLogP | 3.13 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|