C21H19N3OS — CID 78768114
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methylsulfanylphenyl)prop-2-enamide (PubChem CID 78768114) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78768114 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccccc1NC(=O)/C=C/c1cn(CCC#N)c2ccccc12 |
| InChI | InChI=1S/C21H19N3OS/c1-26-20-10-5-3-8-18(20)23-21(25)12-11-16-15-24(14-6-13-22)19-9-4-2-7-17(16)19/h2-5,7-12,15H,6,14H2,1H3,(H,23,25)/b12-11+ |
| InChIKey | HRTHIVKPYCHFLS-VAWYXSNFSA-N |
| XLogP | 4.93 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|