C20H16FN3O3S — CID 86997777
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide (PubChem CID 86997777) has the molecular formula C20H16FN3O3S and a molecular weight of 397.43 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 86997777 |
| Molecular Formula | C20H16FN3O3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)NS(=O)(=O)c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H16FN3O3S/c21-16-7-9-17(10-8-16)28(26,27)23-20(25)11-6-15-14-24(13-3-12-22)19-5-2-1-4-18(15)19/h1-2,4-11,14H,3,13H2,(H,23,25)/b11-6+ |
| InChIKey | HJWDQDRQLUDGSZ-IZZDOVSWSA-N |
| XLogP | 3.21 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|