C18H17N5OS — CID 78769718
3-[1-(2-cyanoethyl)indol-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 78769718) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 3-[1-(2-cyanoethyl)indol-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[1-(2-cyanoethyl)indol-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 78769718 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-[1-(2-cyanoethyl)indol-3-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCc1nnc(NC(=O)C=Cc2cn(CCC#N)c3ccccc23)s1 |
| InChI | InChI=1S/C18H17N5OS/c1-2-17-21-22-18(25-17)20-16(24)9-8-13-12-23(11-5-10-19)15-7-4-3-6-14(13)15/h3-4,6-9,12H,2,5,11H2,1H3,(H,20,22,24) |
| InChIKey | AEJSKNCWUBAVGV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|