C26H20N4O2S — CID 24587192
(E)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide (PubChem CID 24587192) has the molecular formula C26H20N4O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is (E)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 24587192 |
| Molecular Formula | C26H20N4O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (E)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)NCc2ccc(-c3nc4ccccc4s3)o2)c2ccccc21 |
| InChI | InChI=1S/C26H20N4O2S/c27-14-5-15-30-17-18(20-6-1-3-8-22(20)30)10-13-25(31)28-16-19-11-12-23(32-19)26-29-21-7-2-4-9-24(21)33-26/h1-4,6-13,17H,5,15-16H2,(H,28,31)/b13-10+ |
| InChIKey | IOQYEVPTXIPUCL-JLHYYAGUSA-N |
| XLogP | 5.75 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|