C26H24N4OS — CID 42907203
3-[3-[(E)-3-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile (PubChem CID 42907203) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-[3-[(E)-3-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(E)-3-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 42907203 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[3-[(E)-3-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(/C=C/C(=O)N2CCCC(c3nc4ccccc4s3)C2)c2ccccc21 |
| InChI | InChI=1S/C26H24N4OS/c27-14-6-16-29-17-19(21-8-1-3-10-23(21)29)12-13-25(31)30-15-5-7-20(18-30)26-28-22-9-2-4-11-24(22)32-26/h1-4,8-13,17,20H,5-7,15-16,18H2/b13-12+ |
| InChIKey | VLEYJOXJXIIDKX-OUKQBFOZSA-N |
| XLogP | 5.58 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|