C21H19N3O3S — CID 9235430
(E)-1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one (PubChem CID 9235430) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is (E)-1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9235430 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (E)-1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])N1CCC[C@@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C21H19N3O3S/c25-20(12-11-15-6-1-3-9-18(15)24(26)27)23-13-5-7-16(14-23)21-22-17-8-2-4-10-19(17)28-21/h1-4,6,8-12,16H,5,7,13-14H2/b12-11+/t16-/m1/s1 |
| InChIKey | VIOJGTBIDAULOL-LPQFERQCSA-N |
| XLogP | 4.62 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|