C19H18N4O3S — CID 9107897
4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-nitrobenzamide (PubChem CID 9107897) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-nitrobenzamide.
| Compound Name | 4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9107897 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(N2CCC[C@H](c3nc4ccccc4s3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N4O3S/c20-18(24)12-7-8-15(16(10-12)23(25)26)22-9-3-4-13(11-22)19-21-14-5-1-2-6-17(14)27-19/h1-2,5-8,10,13H,3-4,9,11H2,(H2,20,24)/t13-/m0/s1 |
| InChIKey | VQRMEAKULXCFPE-ZDUSSCGKSA-N |
| XLogP | 3.69 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|