C18H17N3O2S — CID 7922983
2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzothiazole (PubChem CID 7922983) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 7922983 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccccc1N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H17N3O2S/c22-21(23)16-7-3-2-6-15(16)20-11-9-13(10-12-20)18-19-14-5-1-4-8-17(14)24-18/h1-8,13H,9-12H2 |
| InChIKey | SZHDUMXXADWVGX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|