C18H17N3O3 — CID 33089272
2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzoxazole (PubChem CID 33089272) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 33089272 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[1-(2-nitrophenyl)piperidin-4-yl]-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccccc1N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C18H17N3O3/c22-21(23)16-7-3-2-6-15(16)20-11-9-13(10-12-20)18-19-14-5-1-4-8-17(14)24-18/h1-8,13H,9-12H2 |
| InChIKey | GBKFWYULAPLHBP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|