C17H18N4O3S — CID 17421706
6-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-3-sulfonamide (PubChem CID 17421706) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 6-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-3-sulfonamide.
| Compound Name | 6-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 17421706 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCC(c3nc4ccccc4o3)CC2)nc1 |
| InChI | InChI=1S/C17H18N4O3S/c18-25(22,23)13-5-6-16(19-11-13)21-9-7-12(8-10-21)17-20-14-3-1-2-4-15(14)24-17/h1-6,11-12H,7-10H2,(H2,18,22,23) |
| InChIKey | MQNYOQAEZBCLPF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |