C22H22N4O5 — CID 25495650
N-[3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 25495650) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 25495650 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[3-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | O=C(NCCC(=O)N1CCC(c2nc3ccccc3o2)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N4O5/c27-20(9-12-23-21(28)15-5-7-17(8-6-15)26(29)30)25-13-10-16(11-14-25)22-24-18-3-1-2-4-19(18)31-22/h1-8,16H,9-14H2,(H,23,28) |
| InChIKey | OJGRHWMDJAZTEW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|