C23H25N3O4 — CID 31187832
N-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethoxybenzamide (PubChem CID 31187832) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethoxybenzamide.
| Compound Name | N-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 31187832 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N2CCC(c3nc4ccccc4o3)CC2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-2-29-18-9-7-16(8-10-18)22(28)24-15-21(27)26-13-11-17(12-14-26)23-25-19-5-3-4-6-20(19)30-23/h3-10,17H,2,11-15H2,1H3,(H,24,28) |
| InChIKey | AEXFHUAABSZQTI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |