C17H25N3O5S — CID 17425383
4-ethoxy-N-[2-[4-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 17425383) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[4-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[4-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17425383 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-ethoxy-N-[2-[4-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N2CCC(NS(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O5S/c1-3-25-15-6-4-13(5-7-15)17(22)18-12-16(21)20-10-8-14(9-11-20)19-26(2,23)24/h4-7,14,19H,3,8-12H2,1-2H3,(H,18,22) |
| InChIKey | QHAHXOGLIWGLBM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |